C7H8F2N2OS — CID 103515721
N-(4,5-dimethyl-1,3-thiazol-2-yl)-2,2-difluoroacetamide (PubChem CID 103515721) has the molecular formula C7H8F2N2OS and a molecular weight of 206.22 g/mol. Its IUPAC name is N-(4,5-dimethyl-1,3-thiazol-2-yl)-2,2-difluoroacetamide.
| Compound Name | N-(4,5-dimethyl-1,3-thiazol-2-yl)-2,2-difluoroacetamide |
|---|---|
| PubChem CID | 103515721 |
| Molecular Formula | C7H8F2N2OS |
| Molecular Weight | 206.22 g/mol |
| Exact Mass | 206.03 |
| IUPAC Name | N-(4,5-dimethyl-1,3-thiazol-2-yl)-2,2-difluoroacetamide |
| SMILES | Cc1nc(NC(=O)C(F)F)sc1C |
| InChI | InChI=1S/C7H8F2N2OS/c1-3-4(2)13-7(10-3)11-6(12)5(8)9/h5H,1-2H3,(H,10,11,12) |
| InChIKey | PYCLCTOEZGGOMY-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.22 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |