C10H17F2NO — CID 103515760
N-(3-ethyl-2-methylcyclopentyl)-2,2-difluoroacetamide (PubChem CID 103515760) has the molecular formula C10H17F2NO and a molecular weight of 205.25 g/mol. Its IUPAC name is N-(3-ethyl-2-methylcyclopentyl)-2,2-difluoroacetamide.
| Compound Name | N-(3-ethyl-2-methylcyclopentyl)-2,2-difluoroacetamide |
|---|---|
| PubChem CID | 103515760 |
| Molecular Formula | C10H17F2NO |
| Molecular Weight | 205.25 g/mol |
| Exact Mass | 205.13 |
| IUPAC Name | N-(3-ethyl-2-methylcyclopentyl)-2,2-difluoroacetamide |
| SMILES | CCC1CCC(NC(=O)C(F)F)C1C |
| InChI | InChI=1S/C10H17F2NO/c1-3-7-4-5-8(6(7)2)13-10(14)9(11)12/h6-9H,3-5H2,1-2H3,(H,13,14) |
| InChIKey | YKBLJLKMHNDCGX-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.25 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |