About 1-(3-ethylsulfonylthiomorpholin-4-yl)-2,2-difluoroethanone
1-(3-ethylsulfonylthiomorpholin-4-yl)-2,2-difluoroethanone (PubChem CID 103515793) has the molecular formula C8H13F2NO3S2
and a molecular weight of 273.33 g/mol. Its IUPAC name is 1-(3-ethylsulfonylthiomorpholin-4-yl)-2,2-difluoroethanone.
Molecular Properties
| Compound Name | 1-(3-ethylsulfonylthiomorpholin-4-yl)-2,2-difluoroethanone |
| PubChem CID | 103515793 |
| Molecular Formula | C8H13F2NO3S2 |
| Molecular Weight | 273.33 g/mol |
| Exact Mass | 273.03 |
| IUPAC Name | 1-(3-ethylsulfonylthiomorpholin-4-yl)-2,2-difluoroethanone |
| SMILES | CCS(=O)(=O)C1CSCCN1C(=O)C(F)F |
| InChI | InChI=1S/C8H13F2NO3S2/c1-2-16(13,14)6-5-15-4-3-11(6)8(12)7(9)10/h6-7H,2-5H2,1H3 |
| InChIKey | VQQZKTNHBTUPCW-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.33 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(3-ethylsulfonylthiomorpholin-4-yl)-2,2-difluoroethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-ethylsulfonylthiomorpholin-4-yl)-2,2-difluoroethanone?
The IUPAC name of 1-(3-ethylsulfonylthiomorpholin-4-yl)-2,2-difluoroethanone (CID 103515793) is 1-(3-ethylsulfonylthiomorpholin-4-yl)-2,2-difluoroethanone.
What is the SMILES notation for 1-(3-ethylsulfonylthiomorpholin-4-yl)-2,2-difluoroethanone?
The canonical SMILES for 1-(3-ethylsulfonylthiomorpholin-4-yl)-2,2-difluoroethanone is CCS(=O)(=O)C1CSCCN1C(=O)C(F)F.
What is the InChIKey of 1-(3-ethylsulfonylthiomorpholin-4-yl)-2,2-difluoroethanone?
The InChIKey is VQQZKTNHBTUPCW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13F2NO3S2/c1-2-16(13,14)6-5-15-4-3-11(6)8(12)7(9)10/h6-7H,2-5H2,1H3.
What are the key properties of 1-(3-ethylsulfonylthiomorpholin-4-yl)-2,2-difluoroethanone?
1-(3-ethylsulfonylthiomorpholin-4-yl)-2,2-difluoroethanone has a molecular weight of 273.33 g/mol, XLogP of 0.59, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-ethylsulfonylthiomorpholin-4-yl)-2,2-difluoroethanone is sourced from PubChem (CID 103515793), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).