C8H12F2N2O2 — CID 103515809
N-cyclopropyl-3-[(2,2-difluoroacetyl)amino]propanamide (PubChem CID 103515809) has the molecular formula C8H12F2N2O2 and a molecular weight of 206.19 g/mol. Its IUPAC name is N-cyclopropyl-3-[(2,2-difluoroacetyl)amino]propanamide.
| Compound Name | N-cyclopropyl-3-[(2,2-difluoroacetyl)amino]propanamide |
|---|---|
| PubChem CID | 103515809 |
| Molecular Formula | C8H12F2N2O2 |
| Molecular Weight | 206.19 g/mol |
| Exact Mass | 206.09 |
| IUPAC Name | N-cyclopropyl-3-[(2,2-difluoroacetyl)amino]propanamide |
| SMILES | O=C(CCNC(=O)C(F)F)NC1CC1 |
| InChI | InChI=1S/C8H12F2N2O2/c9-7(10)8(14)11-4-3-6(13)12-5-1-2-5/h5,7H,1-4H2,(H,11,14)(H,12,13) |
| InChIKey | IUAQRGRQQYMUFC-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.19 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |