C10H10BrF2NO — CID 103515890
N-[(1R)-1-(2-bromophenyl)ethyl]-2,2-difluoroacetamide (PubChem CID 103515890) has the molecular formula C10H10BrF2NO and a molecular weight of 278.10 g/mol. Its IUPAC name is N-[(1R)-1-(2-bromophenyl)ethyl]-2,2-difluoroacetamide.
| Compound Name | N-[(1R)-1-(2-bromophenyl)ethyl]-2,2-difluoroacetamide |
|---|---|
| PubChem CID | 103515890 |
| Molecular Formula | C10H10BrF2NO |
| Molecular Weight | 278.10 g/mol |
| Exact Mass | 276.99 |
| IUPAC Name | N-[(1R)-1-(2-bromophenyl)ethyl]-2,2-difluoroacetamide |
| SMILES | C[C@@H](NC(=O)C(F)F)c1ccccc1Br |
| InChI | InChI=1S/C10H10BrF2NO/c1-6(14-10(15)9(12)13)7-4-2-3-5-8(7)11/h2-6,9H,1H3,(H,14,15)/t6-/m1/s1 |
| InChIKey | IAXJREACFWOBHG-ZCFIWIBFSA-N |
| XLogP | 2.89 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.10 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |