C11H14F2N2O — CID 103515923
N-[3-(dimethylamino)-4-methylphenyl]-2,2-difluoroacetamide (PubChem CID 103515923) has the molecular formula C11H14F2N2O and a molecular weight of 228.24 g/mol. Its IUPAC name is N-[3-(dimethylamino)-4-methylphenyl]-2,2-difluoroacetamide.
| Compound Name | N-[3-(dimethylamino)-4-methylphenyl]-2,2-difluoroacetamide |
|---|---|
| PubChem CID | 103515923 |
| Molecular Formula | C11H14F2N2O |
| Molecular Weight | 228.24 g/mol |
| Exact Mass | 228.11 |
| IUPAC Name | N-[3-(dimethylamino)-4-methylphenyl]-2,2-difluoroacetamide |
| SMILES | Cc1ccc(NC(=O)C(F)F)cc1N(C)C |
| InChI | InChI=1S/C11H14F2N2O/c1-7-4-5-8(6-9(7)15(2)3)14-11(16)10(12)13/h4-6,10H,1-3H3,(H,14,16) |
| InChIKey | XYIRXWSEEFUDBM-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.24 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |