C8H13F2NO — CID 103516050
N-(2-cyclobutylethyl)-2,2-difluoroacetamide (PubChem CID 103516050) has the molecular formula C8H13F2NO and a molecular weight of 177.19 g/mol. Its IUPAC name is N-(2-cyclobutylethyl)-2,2-difluoroacetamide.
| Compound Name | N-(2-cyclobutylethyl)-2,2-difluoroacetamide |
|---|---|
| PubChem CID | 103516050 |
| Molecular Formula | C8H13F2NO |
| Molecular Weight | 177.19 g/mol |
| Exact Mass | 177.10 |
| IUPAC Name | N-(2-cyclobutylethyl)-2,2-difluoroacetamide |
| SMILES | O=C(NCCC1CCC1)C(F)F |
| InChI | InChI=1S/C8H13F2NO/c9-7(10)8(12)11-5-4-6-2-1-3-6/h6-7H,1-5H2,(H,11,12) |
| InChIKey | LLNZYUKHWAWIOG-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.19 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |