About N-(1,4-dithian-2-ylmethyl)-2,2-difluoroacetamide
N-(1,4-dithian-2-ylmethyl)-2,2-difluoroacetamide (PubChem CID 103516065) has the molecular formula C7H11F2NOS2
and a molecular weight of 227.30 g/mol. Its IUPAC name is N-(1,4-dithian-2-ylmethyl)-2,2-difluoroacetamide.
Molecular Properties
| Compound Name | N-(1,4-dithian-2-ylmethyl)-2,2-difluoroacetamide |
| PubChem CID | 103516065 |
| Molecular Formula | C7H11F2NOS2 |
| Molecular Weight | 227.30 g/mol |
| Exact Mass | 227.03 |
| IUPAC Name | N-(1,4-dithian-2-ylmethyl)-2,2-difluoroacetamide |
| SMILES | O=C(NCC1CSCCS1)C(F)F |
| InChI | InChI=1S/C7H11F2NOS2/c8-6(9)7(11)10-3-5-4-12-1-2-13-5/h5-6H,1-4H2,(H,10,11) |
| InChIKey | WGJUHVRUFNZTOM-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.30 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(1,4-dithian-2-ylmethyl)-2,2-difluoroacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1,4-dithian-2-ylmethyl)-2,2-difluoroacetamide?
The IUPAC name of N-(1,4-dithian-2-ylmethyl)-2,2-difluoroacetamide (CID 103516065) is N-(1,4-dithian-2-ylmethyl)-2,2-difluoroacetamide.
What is the SMILES notation for N-(1,4-dithian-2-ylmethyl)-2,2-difluoroacetamide?
The canonical SMILES for N-(1,4-dithian-2-ylmethyl)-2,2-difluoroacetamide is O=C(NCC1CSCCS1)C(F)F.
What is the InChIKey of N-(1,4-dithian-2-ylmethyl)-2,2-difluoroacetamide?
The InChIKey is WGJUHVRUFNZTOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11F2NOS2/c8-6(9)7(11)10-3-5-4-12-1-2-13-5/h5-6H,1-4H2,(H,10,11).
What are the key properties of N-(1,4-dithian-2-ylmethyl)-2,2-difluoroacetamide?
N-(1,4-dithian-2-ylmethyl)-2,2-difluoroacetamide has a molecular weight of 227.30 g/mol, XLogP of 1.22, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1,4-dithian-2-ylmethyl)-2,2-difluoroacetamide is sourced from PubChem (CID 103516065), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).