About N-(4-bromo-3-oxobutyl)-2,2-difluoroacetamide
N-(4-bromo-3-oxobutyl)-2,2-difluoroacetamide (PubChem CID 103516173) has the molecular formula C6H8BrF2NO2
and a molecular weight of 244.03 g/mol. Its IUPAC name is N-(4-bromo-3-oxobutyl)-2,2-difluoroacetamide.
Molecular Properties
| Compound Name | N-(4-bromo-3-oxobutyl)-2,2-difluoroacetamide |
| PubChem CID | 103516173 |
| Molecular Formula | C6H8BrF2NO2 |
| Molecular Weight | 244.03 g/mol |
| Exact Mass | 242.97 |
| IUPAC Name | N-(4-bromo-3-oxobutyl)-2,2-difluoroacetamide |
| SMILES | O=C(CBr)CCNC(=O)C(F)F |
| InChI | InChI=1S/C6H8BrF2NO2/c7-3-4(11)1-2-10-6(12)5(8)9/h5H,1-3H2,(H,10,12) |
| InChIKey | BMYNQJDVZLODPM-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.03 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze N-(4-bromo-3-oxobutyl)-2,2-difluoroacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-bromo-3-oxobutyl)-2,2-difluoroacetamide?
The IUPAC name of N-(4-bromo-3-oxobutyl)-2,2-difluoroacetamide (CID 103516173) is N-(4-bromo-3-oxobutyl)-2,2-difluoroacetamide.
What is the SMILES notation for N-(4-bromo-3-oxobutyl)-2,2-difluoroacetamide?
The canonical SMILES for N-(4-bromo-3-oxobutyl)-2,2-difluoroacetamide is O=C(CBr)CCNC(=O)C(F)F.
What is the InChIKey of N-(4-bromo-3-oxobutyl)-2,2-difluoroacetamide?
The InChIKey is BMYNQJDVZLODPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8BrF2NO2/c7-3-4(11)1-2-10-6(12)5(8)9/h5H,1-3H2,(H,10,12).
What are the key properties of N-(4-bromo-3-oxobutyl)-2,2-difluoroacetamide?
N-(4-bromo-3-oxobutyl)-2,2-difluoroacetamide has a molecular weight of 244.03 g/mol, XLogP of 0.72, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-bromo-3-oxobutyl)-2,2-difluoroacetamide is sourced from PubChem (CID 103516173), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).