About N-(4-bromo-3-oxobutyl)-2,2-difluoro-N-methylacetamide
N-(4-bromo-3-oxobutyl)-2,2-difluoro-N-methylacetamide (PubChem CID 103516253) has the molecular formula C7H10BrF2NO2
and a molecular weight of 258.06 g/mol. Its IUPAC name is N-(4-bromo-3-oxobutyl)-2,2-difluoro-N-methylacetamide.
Molecular Properties
| Compound Name | N-(4-bromo-3-oxobutyl)-2,2-difluoro-N-methylacetamide |
| PubChem CID | 103516253 |
| Molecular Formula | C7H10BrF2NO2 |
| Molecular Weight | 258.06 g/mol |
| Exact Mass | 256.99 |
| IUPAC Name | N-(4-bromo-3-oxobutyl)-2,2-difluoro-N-methylacetamide |
| SMILES | CN(CCC(=O)CBr)C(=O)C(F)F |
| InChI | InChI=1S/C7H10BrF2NO2/c1-11(7(13)6(9)10)3-2-5(12)4-8/h6H,2-4H2,1H3 |
| InChIKey | MYJSQAKUCLIRRO-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.06 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze N-(4-bromo-3-oxobutyl)-2,2-difluoro-N-methylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-bromo-3-oxobutyl)-2,2-difluoro-N-methylacetamide?
The IUPAC name of N-(4-bromo-3-oxobutyl)-2,2-difluoro-N-methylacetamide (CID 103516253) is N-(4-bromo-3-oxobutyl)-2,2-difluoro-N-methylacetamide.
What is the SMILES notation for N-(4-bromo-3-oxobutyl)-2,2-difluoro-N-methylacetamide?
The canonical SMILES for N-(4-bromo-3-oxobutyl)-2,2-difluoro-N-methylacetamide is CN(CCC(=O)CBr)C(=O)C(F)F.
What is the InChIKey of N-(4-bromo-3-oxobutyl)-2,2-difluoro-N-methylacetamide?
The InChIKey is MYJSQAKUCLIRRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10BrF2NO2/c1-11(7(13)6(9)10)3-2-5(12)4-8/h6H,2-4H2,1H3.
What are the key properties of N-(4-bromo-3-oxobutyl)-2,2-difluoro-N-methylacetamide?
N-(4-bromo-3-oxobutyl)-2,2-difluoro-N-methylacetamide has a molecular weight of 258.06 g/mol, XLogP of 1.06, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-bromo-3-oxobutyl)-2,2-difluoro-N-methylacetamide is sourced from PubChem (CID 103516253), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).