About 2-hydroxypentanal
2-hydroxypentanal (PubChem CID 10351658) has the molecular formula C5H10O2
and a molecular weight of 102.13 g/mol. Its IUPAC name is 2-hydroxypentanal.
Molecular Properties
| Compound Name | 2-hydroxypentanal |
| PubChem CID | 10351658 |
| Molecular Formula | C5H10O2 |
| Molecular Weight | 102.13 g/mol |
| Exact Mass | 102.07 |
| IUPAC Name | 2-hydroxypentanal |
| SMILES | CCCC(O)C=O |
| InChI | InChI=1S/C5H10O2/c1-2-3-5(7)4-6/h4-5,7H,2-3H2,1H3 |
| InChIKey | SUTLBTHMXYSMSZ-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 102.13 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxypentanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxypentanal?
The IUPAC name of 2-hydroxypentanal (CID 10351658) is 2-hydroxypentanal.
What is the SMILES notation for 2-hydroxypentanal?
The canonical SMILES for 2-hydroxypentanal is CCCC(O)C=O.
What is the InChIKey of 2-hydroxypentanal?
The InChIKey is SUTLBTHMXYSMSZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10O2/c1-2-3-5(7)4-6/h4-5,7H,2-3H2,1H3.
What are the key properties of 2-hydroxypentanal?
2-hydroxypentanal has a molecular weight of 102.13 g/mol, XLogP of 0.35, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxypentanal is sourced from PubChem (CID 10351658), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).