C11H13Cl2F2N — CID 103516664
3-(2,5-dichlorophenyl)-N-ethyl-1,1-difluoropropan-2-amine (PubChem CID 103516664) has the molecular formula C11H13Cl2F2N and a molecular weight of 268.13 g/mol. Its IUPAC name is 3-(2,5-dichlorophenyl)-N-ethyl-1,1-difluoropropan-2-amine.
| Compound Name | 3-(2,5-dichlorophenyl)-N-ethyl-1,1-difluoropropan-2-amine |
|---|---|
| PubChem CID | 103516664 |
| Molecular Formula | C11H13Cl2F2N |
| Molecular Weight | 268.13 g/mol |
| Exact Mass | 267.04 |
| IUPAC Name | 3-(2,5-dichlorophenyl)-N-ethyl-1,1-difluoropropan-2-amine |
| SMILES | CCNC(Cc1cc(Cl)ccc1Cl)C(F)F |
| InChI | InChI=1S/C11H13Cl2F2N/c1-2-16-10(11(14)15)6-7-5-8(12)3-4-9(7)13/h3-5,10-11,16H,2,6H2,1H3 |
| InChIKey | YIIXZBKUZMQLDN-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.13 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |