About 3-(4-bromo-1,3-diethylpyrazol-5-yl)-1,1-difluoropropan-2-amine
3-(4-bromo-1,3-diethylpyrazol-5-yl)-1,1-difluoropropan-2-amine (PubChem CID 103516813) has the molecular formula C10H16BrF2N3
and a molecular weight of 296.16 g/mol. Its IUPAC name is 3-(4-bromo-1,3-diethylpyrazol-5-yl)-1,1-difluoropropan-2-amine.
Molecular Properties
| Compound Name | 3-(4-bromo-1,3-diethylpyrazol-5-yl)-1,1-difluoropropan-2-amine |
| PubChem CID | 103516813 |
| Molecular Formula | C10H16BrF2N3 |
| Molecular Weight | 296.16 g/mol |
| Exact Mass | 295.05 |
| IUPAC Name | 3-(4-bromo-1,3-diethylpyrazol-5-yl)-1,1-difluoropropan-2-amine |
| SMILES | CCc1nn(CC)c(CC(N)C(F)F)c1Br |
| InChI | InChI=1S/C10H16BrF2N3/c1-3-7-9(11)8(16(4-2)15-7)5-6(14)10(12)13/h6,10H,3-5,14H2,1-2H3 |
| InChIKey | DARXWJLGEVIXQE-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.16 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(4-bromo-1,3-diethylpyrazol-5-yl)-1,1-difluoropropan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-bromo-1,3-diethylpyrazol-5-yl)-1,1-difluoropropan-2-amine?
The IUPAC name of 3-(4-bromo-1,3-diethylpyrazol-5-yl)-1,1-difluoropropan-2-amine (CID 103516813) is 3-(4-bromo-1,3-diethylpyrazol-5-yl)-1,1-difluoropropan-2-amine.
What is the SMILES notation for 3-(4-bromo-1,3-diethylpyrazol-5-yl)-1,1-difluoropropan-2-amine?
The canonical SMILES for 3-(4-bromo-1,3-diethylpyrazol-5-yl)-1,1-difluoropropan-2-amine is CCc1nn(CC)c(CC(N)C(F)F)c1Br.
What is the InChIKey of 3-(4-bromo-1,3-diethylpyrazol-5-yl)-1,1-difluoropropan-2-amine?
The InChIKey is DARXWJLGEVIXQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16BrF2N3/c1-3-7-9(11)8(16(4-2)15-7)5-6(14)10(12)13/h6,10H,3-5,14H2,1-2H3.
What are the key properties of 3-(4-bromo-1,3-diethylpyrazol-5-yl)-1,1-difluoropropan-2-amine?
3-(4-bromo-1,3-diethylpyrazol-5-yl)-1,1-difluoropropan-2-amine has a molecular weight of 296.16 g/mol, XLogP of 2.36, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-bromo-1,3-diethylpyrazol-5-yl)-1,1-difluoropropan-2-amine is sourced from PubChem (CID 103516813), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).