About 1-(1,9-dioxaspiro[5.5]undecan-4-yl)-2,2-difluoroethanamine
1-(1,9-dioxaspiro[5.5]undecan-4-yl)-2,2-difluoroethanamine (PubChem CID 103516890) has the molecular formula C11H19F2NO2
and a molecular weight of 235.27 g/mol. Its IUPAC name is 1-(1,9-dioxaspiro[5.5]undecan-4-yl)-2,2-difluoroethanamine.
Molecular Properties
| Compound Name | 1-(1,9-dioxaspiro[5.5]undecan-4-yl)-2,2-difluoroethanamine |
| PubChem CID | 103516890 |
| Molecular Formula | C11H19F2NO2 |
| Molecular Weight | 235.27 g/mol |
| Exact Mass | 235.14 |
| IUPAC Name | 1-(1,9-dioxaspiro[5.5]undecan-4-yl)-2,2-difluoroethanamine |
| SMILES | NC(C(F)F)C1CCOC2(CCOCC2)C1 |
| InChI | InChI=1S/C11H19F2NO2/c12-10(13)9(14)8-1-4-16-11(7-8)2-5-15-6-3-11/h8-10H,1-7,14H2 |
| InChIKey | PTZZRIIQWJVXAJ-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.27 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(1,9-dioxaspiro[5.5]undecan-4-yl)-2,2-difluoroethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1,9-dioxaspiro[5.5]undecan-4-yl)-2,2-difluoroethanamine?
The IUPAC name of 1-(1,9-dioxaspiro[5.5]undecan-4-yl)-2,2-difluoroethanamine (CID 103516890) is 1-(1,9-dioxaspiro[5.5]undecan-4-yl)-2,2-difluoroethanamine.
What is the SMILES notation for 1-(1,9-dioxaspiro[5.5]undecan-4-yl)-2,2-difluoroethanamine?
The canonical SMILES for 1-(1,9-dioxaspiro[5.5]undecan-4-yl)-2,2-difluoroethanamine is NC(C(F)F)C1CCOC2(CCOCC2)C1.
What is the InChIKey of 1-(1,9-dioxaspiro[5.5]undecan-4-yl)-2,2-difluoroethanamine?
The InChIKey is PTZZRIIQWJVXAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19F2NO2/c12-10(13)9(14)8-1-4-16-11(7-8)2-5-15-6-3-11/h8-10H,1-7,14H2.
What are the key properties of 1-(1,9-dioxaspiro[5.5]undecan-4-yl)-2,2-difluoroethanamine?
1-(1,9-dioxaspiro[5.5]undecan-4-yl)-2,2-difluoroethanamine has a molecular weight of 235.27 g/mol, XLogP of 1.55, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,9-dioxaspiro[5.5]undecan-4-yl)-2,2-difluoroethanamine is sourced from PubChem (CID 103516890), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).