About N-[2,2-difluoro-1-(1-oxa-9-thiaspiro[5.5]undecan-4-yl)ethyl]propan-1-amine
N-[2,2-difluoro-1-(1-oxa-9-thiaspiro[5.5]undecan-4-yl)ethyl]propan-1-amine (PubChem CID 103516941) has the molecular formula C14H25F2NOS
and a molecular weight of 293.42 g/mol. Its IUPAC name is N-[2,2-difluoro-1-(1-oxa-9-thiaspiro[5.5]undecan-4-yl)ethyl]propan-1-amine.
Molecular Properties
| Compound Name | N-[2,2-difluoro-1-(1-oxa-9-thiaspiro[5.5]undecan-4-yl)ethyl]propan-1-amine |
| PubChem CID | 103516941 |
| Molecular Formula | C14H25F2NOS |
| Molecular Weight | 293.42 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | N-[2,2-difluoro-1-(1-oxa-9-thiaspiro[5.5]undecan-4-yl)ethyl]propan-1-amine |
| SMILES | CCCNC(C(F)F)C1CCOC2(CCSCC2)C1 |
| InChI | InChI=1S/C14H25F2NOS/c1-2-6-17-12(13(15)16)11-3-7-18-14(10-11)4-8-19-9-5-14/h11-13,17H,2-10H2,1H3 |
| InChIKey | PFWNSIOQUIQBJH-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.42 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[2,2-difluoro-1-(1-oxa-9-thiaspiro[5.5]undecan-4-yl)ethyl]propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2,2-difluoro-1-(1-oxa-9-thiaspiro[5.5]undecan-4-yl)ethyl]propan-1-amine?
The IUPAC name of N-[2,2-difluoro-1-(1-oxa-9-thiaspiro[5.5]undecan-4-yl)ethyl]propan-1-amine (CID 103516941) is N-[2,2-difluoro-1-(1-oxa-9-thiaspiro[5.5]undecan-4-yl)ethyl]propan-1-amine.
What is the SMILES notation for N-[2,2-difluoro-1-(1-oxa-9-thiaspiro[5.5]undecan-4-yl)ethyl]propan-1-amine?
The canonical SMILES for N-[2,2-difluoro-1-(1-oxa-9-thiaspiro[5.5]undecan-4-yl)ethyl]propan-1-amine is CCCNC(C(F)F)C1CCOC2(CCSCC2)C1.
What is the InChIKey of N-[2,2-difluoro-1-(1-oxa-9-thiaspiro[5.5]undecan-4-yl)ethyl]propan-1-amine?
The InChIKey is PFWNSIOQUIQBJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H25F2NOS/c1-2-6-17-12(13(15)16)11-3-7-18-14(10-11)4-8-19-9-5-14/h11-13,17H,2-10H2,1H3.
What are the key properties of N-[2,2-difluoro-1-(1-oxa-9-thiaspiro[5.5]undecan-4-yl)ethyl]propan-1-amine?
N-[2,2-difluoro-1-(1-oxa-9-thiaspiro[5.5]undecan-4-yl)ethyl]propan-1-amine has a molecular weight of 293.42 g/mol, XLogP of 3.31, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2,2-difluoro-1-(1-oxa-9-thiaspiro[5.5]undecan-4-yl)ethyl]propan-1-amine is sourced from PubChem (CID 103516941), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).