About 1-(3,4-dihydro-2H-pyran-5-yl)-2,2-difluoroethanamine
1-(3,4-dihydro-2H-pyran-5-yl)-2,2-difluoroethanamine (PubChem CID 103517061) has the molecular formula C7H11F2NO
and a molecular weight of 163.17 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-pyran-5-yl)-2,2-difluoroethanamine.
Molecular Properties
| Compound Name | 1-(3,4-dihydro-2H-pyran-5-yl)-2,2-difluoroethanamine |
| PubChem CID | 103517061 |
| Molecular Formula | C7H11F2NO |
| Molecular Weight | 163.17 g/mol |
| Exact Mass | 163.08 |
| IUPAC Name | 1-(3,4-dihydro-2H-pyran-5-yl)-2,2-difluoroethanamine |
| SMILES | NC(C1=COCCC1)C(F)F |
| InChI | InChI=1S/C7H11F2NO/c8-7(9)6(10)5-2-1-3-11-4-5/h4,6-7H,1-3,10H2 |
| InChIKey | KTDNAWPTFPIJDB-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.17 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(3,4-dihydro-2H-pyran-5-yl)-2,2-difluoroethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,4-dihydro-2H-pyran-5-yl)-2,2-difluoroethanamine?
The IUPAC name of 1-(3,4-dihydro-2H-pyran-5-yl)-2,2-difluoroethanamine (CID 103517061) is 1-(3,4-dihydro-2H-pyran-5-yl)-2,2-difluoroethanamine.
What is the SMILES notation for 1-(3,4-dihydro-2H-pyran-5-yl)-2,2-difluoroethanamine?
The canonical SMILES for 1-(3,4-dihydro-2H-pyran-5-yl)-2,2-difluoroethanamine is NC(C1=COCCC1)C(F)F.
What is the InChIKey of 1-(3,4-dihydro-2H-pyran-5-yl)-2,2-difluoroethanamine?
The InChIKey is KTDNAWPTFPIJDB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11F2NO/c8-7(9)6(10)5-2-1-3-11-4-5/h4,6-7H,1-3,10H2.
What are the key properties of 1-(3,4-dihydro-2H-pyran-5-yl)-2,2-difluoroethanamine?
1-(3,4-dihydro-2H-pyran-5-yl)-2,2-difluoroethanamine has a molecular weight of 163.17 g/mol, XLogP of 1.27, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,4-dihydro-2H-pyran-5-yl)-2,2-difluoroethanamine is sourced from PubChem (CID 103517061), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).