C11H12F2N4 — CID 103517148
2,2-difluoro-N-methyl-1-(3-phenyltriazol-4-yl)ethanamine (PubChem CID 103517148) has the molecular formula C11H12F2N4 and a molecular weight of 238.24 g/mol. Its IUPAC name is 2,2-difluoro-N-methyl-1-(3-phenyltriazol-4-yl)ethanamine.
| Compound Name | 2,2-difluoro-N-methyl-1-(3-phenyltriazol-4-yl)ethanamine |
|---|---|
| PubChem CID | 103517148 |
| Molecular Formula | C11H12F2N4 |
| Molecular Weight | 238.24 g/mol |
| Exact Mass | 238.10 |
| IUPAC Name | 2,2-difluoro-N-methyl-1-(3-phenyltriazol-4-yl)ethanamine |
| SMILES | CNC(c1cnnn1-c1ccccc1)C(F)F |
| InChI | InChI=1S/C11H12F2N4/c1-14-10(11(12)13)9-7-15-16-17(9)8-5-3-2-4-6-8/h2-7,10-11,14H,1H3 |
| InChIKey | XOIZRVGYOKLBAN-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.24 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |