About 1-hydroxyhept-6-en-2-one
1-hydroxyhept-6-en-2-one (PubChem CID 10351718) has the molecular formula C7H12O2
and a molecular weight of 128.17 g/mol. Its IUPAC name is 1-hydroxyhept-6-en-2-one.
Molecular Properties
| Compound Name | 1-hydroxyhept-6-en-2-one |
| PubChem CID | 10351718 |
| Molecular Formula | C7H12O2 |
| Molecular Weight | 128.17 g/mol |
| Exact Mass | 128.08 |
| IUPAC Name | 1-hydroxyhept-6-en-2-one |
| SMILES | C=CCCCC(=O)CO |
| InChI | InChI=1S/C7H12O2/c1-2-3-4-5-7(9)6-8/h2,8H,1,3-6H2 |
| InChIKey | XARQHLQYGWTGCA-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.17 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-hydroxyhept-6-en-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hydroxyhept-6-en-2-one?
The IUPAC name of 1-hydroxyhept-6-en-2-one (CID 10351718) is 1-hydroxyhept-6-en-2-one.
What is the SMILES notation for 1-hydroxyhept-6-en-2-one?
The canonical SMILES for 1-hydroxyhept-6-en-2-one is C=CCCCC(=O)CO.
What is the InChIKey of 1-hydroxyhept-6-en-2-one?
The InChIKey is XARQHLQYGWTGCA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12O2/c1-2-3-4-5-7(9)6-8/h2,8H,1,3-6H2.
What are the key properties of 1-hydroxyhept-6-en-2-one?
1-hydroxyhept-6-en-2-one has a molecular weight of 128.17 g/mol, XLogP of 0.90, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hydroxyhept-6-en-2-one is sourced from PubChem (CID 10351718), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).