C10H8ClF2NO — CID 103517192
1-(7-chloro-1-benzofuran-2-yl)-2,2-difluoroethanamine (PubChem CID 103517192) has the molecular formula C10H8ClF2NO and a molecular weight of 231.63 g/mol. Its IUPAC name is 1-(7-chloro-1-benzofuran-2-yl)-2,2-difluoroethanamine.
| Compound Name | 1-(7-chloro-1-benzofuran-2-yl)-2,2-difluoroethanamine |
|---|---|
| PubChem CID | 103517192 |
| Molecular Formula | C10H8ClF2NO |
| Molecular Weight | 231.63 g/mol |
| Exact Mass | 231.03 |
| IUPAC Name | 1-(7-chloro-1-benzofuran-2-yl)-2,2-difluoroethanamine |
| SMILES | NC(c1cc2cccc(Cl)c2o1)C(F)F |
| InChI | InChI=1S/C10H8ClF2NO/c11-6-3-1-2-5-4-7(15-9(5)6)8(14)10(12)13/h1-4,8,10H,14H2 |
| InChIKey | NWSUCJSYXZOJBO-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 39.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.63 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |