About 1-(3,4-dihydro-2H-pyran-6-yl)-N-ethyl-2,2-difluoroethanamine
1-(3,4-dihydro-2H-pyran-6-yl)-N-ethyl-2,2-difluoroethanamine (PubChem CID 103517266) has the molecular formula C9H15F2NO
and a molecular weight of 191.22 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-pyran-6-yl)-N-ethyl-2,2-difluoroethanamine.
Molecular Properties
| Compound Name | 1-(3,4-dihydro-2H-pyran-6-yl)-N-ethyl-2,2-difluoroethanamine |
| PubChem CID | 103517266 |
| Molecular Formula | C9H15F2NO |
| Molecular Weight | 191.22 g/mol |
| Exact Mass | 191.11 |
| IUPAC Name | 1-(3,4-dihydro-2H-pyran-6-yl)-N-ethyl-2,2-difluoroethanamine |
| SMILES | CCNC(C1=CCCCO1)C(F)F |
| InChI | InChI=1S/C9H15F2NO/c1-2-12-8(9(10)11)7-5-3-4-6-13-7/h5,8-9,12H,2-4,6H2,1H3 |
| InChIKey | RCZKMHNNDLMINT-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.22 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(3,4-dihydro-2H-pyran-6-yl)-N-ethyl-2,2-difluoroethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,4-dihydro-2H-pyran-6-yl)-N-ethyl-2,2-difluoroethanamine?
The IUPAC name of 1-(3,4-dihydro-2H-pyran-6-yl)-N-ethyl-2,2-difluoroethanamine (CID 103517266) is 1-(3,4-dihydro-2H-pyran-6-yl)-N-ethyl-2,2-difluoroethanamine.
What is the SMILES notation for 1-(3,4-dihydro-2H-pyran-6-yl)-N-ethyl-2,2-difluoroethanamine?
The canonical SMILES for 1-(3,4-dihydro-2H-pyran-6-yl)-N-ethyl-2,2-difluoroethanamine is CCNC(C1=CCCCO1)C(F)F.
What is the InChIKey of 1-(3,4-dihydro-2H-pyran-6-yl)-N-ethyl-2,2-difluoroethanamine?
The InChIKey is RCZKMHNNDLMINT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15F2NO/c1-2-12-8(9(10)11)7-5-3-4-6-13-7/h5,8-9,12H,2-4,6H2,1H3.
What are the key properties of 1-(3,4-dihydro-2H-pyran-6-yl)-N-ethyl-2,2-difluoroethanamine?
1-(3,4-dihydro-2H-pyran-6-yl)-N-ethyl-2,2-difluoroethanamine has a molecular weight of 191.22 g/mol, XLogP of 1.92, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,4-dihydro-2H-pyran-6-yl)-N-ethyl-2,2-difluoroethanamine is sourced from PubChem (CID 103517266), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).