About N-[1-(2,3-dihydrofuran-5-yl)-2,2-difluoroethyl]propan-1-amine
N-[1-(2,3-dihydrofuran-5-yl)-2,2-difluoroethyl]propan-1-amine (PubChem CID 103517269) has the molecular formula C9H15F2NO
and a molecular weight of 191.22 g/mol. Its IUPAC name is N-[1-(2,3-dihydrofuran-5-yl)-2,2-difluoroethyl]propan-1-amine.
Molecular Properties
| Compound Name | N-[1-(2,3-dihydrofuran-5-yl)-2,2-difluoroethyl]propan-1-amine |
| PubChem CID | 103517269 |
| Molecular Formula | C9H15F2NO |
| Molecular Weight | 191.22 g/mol |
| Exact Mass | 191.11 |
| IUPAC Name | N-[1-(2,3-dihydrofuran-5-yl)-2,2-difluoroethyl]propan-1-amine |
| SMILES | CCCNC(C1=CCCO1)C(F)F |
| InChI | InChI=1S/C9H15F2NO/c1-2-5-12-8(9(10)11)7-4-3-6-13-7/h4,8-9,12H,2-3,5-6H2,1H3 |
| InChIKey | WTBRFPLZDGPUKW-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.22 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[1-(2,3-dihydrofuran-5-yl)-2,2-difluoroethyl]propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-(2,3-dihydrofuran-5-yl)-2,2-difluoroethyl]propan-1-amine?
The IUPAC name of N-[1-(2,3-dihydrofuran-5-yl)-2,2-difluoroethyl]propan-1-amine (CID 103517269) is N-[1-(2,3-dihydrofuran-5-yl)-2,2-difluoroethyl]propan-1-amine.
What is the SMILES notation for N-[1-(2,3-dihydrofuran-5-yl)-2,2-difluoroethyl]propan-1-amine?
The canonical SMILES for N-[1-(2,3-dihydrofuran-5-yl)-2,2-difluoroethyl]propan-1-amine is CCCNC(C1=CCCO1)C(F)F.
What is the InChIKey of N-[1-(2,3-dihydrofuran-5-yl)-2,2-difluoroethyl]propan-1-amine?
The InChIKey is WTBRFPLZDGPUKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15F2NO/c1-2-5-12-8(9(10)11)7-4-3-6-13-7/h4,8-9,12H,2-3,5-6H2,1H3.
What are the key properties of N-[1-(2,3-dihydrofuran-5-yl)-2,2-difluoroethyl]propan-1-amine?
N-[1-(2,3-dihydrofuran-5-yl)-2,2-difluoroethyl]propan-1-amine has a molecular weight of 191.22 g/mol, XLogP of 1.92, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-(2,3-dihydrofuran-5-yl)-2,2-difluoroethyl]propan-1-amine is sourced from PubChem (CID 103517269), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).