About 6-ethenyl-2,5-dimethyl-2,3-dihydropyrazine
6-ethenyl-2,5-dimethyl-2,3-dihydropyrazine (PubChem CID 10351754) has the molecular formula C8H12N2
and a molecular weight of 136.20 g/mol. Its IUPAC name is 6-ethenyl-2,5-dimethyl-2,3-dihydropyrazine.
Molecular Properties
| Compound Name | 6-ethenyl-2,5-dimethyl-2,3-dihydropyrazine |
| PubChem CID | 10351754 |
| Molecular Formula | C8H12N2 |
| Molecular Weight | 136.20 g/mol |
| Exact Mass | 136.10 |
| IUPAC Name | 6-ethenyl-2,5-dimethyl-2,3-dihydropyrazine |
| SMILES | C=CC1=NC(C)CN=C1C |
| InChI | InChI=1S/C8H12N2/c1-4-8-7(3)9-5-6(2)10-8/h4,6H,1,5H2,2-3H3 |
| InChIKey | RBRNMLWVFMDICC-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.20 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-ethenyl-2,5-dimethyl-2,3-dihydropyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-ethenyl-2,5-dimethyl-2,3-dihydropyrazine?
The IUPAC name of 6-ethenyl-2,5-dimethyl-2,3-dihydropyrazine (CID 10351754) is 6-ethenyl-2,5-dimethyl-2,3-dihydropyrazine.
What is the SMILES notation for 6-ethenyl-2,5-dimethyl-2,3-dihydropyrazine?
The canonical SMILES for 6-ethenyl-2,5-dimethyl-2,3-dihydropyrazine is C=CC1=NC(C)CN=C1C.
What is the InChIKey of 6-ethenyl-2,5-dimethyl-2,3-dihydropyrazine?
The InChIKey is RBRNMLWVFMDICC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2/c1-4-8-7(3)9-5-6(2)10-8/h4,6H,1,5H2,2-3H3.
What are the key properties of 6-ethenyl-2,5-dimethyl-2,3-dihydropyrazine?
6-ethenyl-2,5-dimethyl-2,3-dihydropyrazine has a molecular weight of 136.20 g/mol, XLogP of 1.48, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethenyl-2,5-dimethyl-2,3-dihydropyrazine is sourced from PubChem (CID 10351754), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).