About 3-prop-2-enoyl-1,3-oxazolidin-2-one
3-prop-2-enoyl-1,3-oxazolidin-2-one (PubChem CID 10351788) has the molecular formula C6H7NO3
and a molecular weight of 141.13 g/mol. Its IUPAC name is 3-prop-2-enoyl-1,3-oxazolidin-2-one.
Molecular Properties
| Compound Name | 3-prop-2-enoyl-1,3-oxazolidin-2-one |
| PubChem CID | 10351788 |
| Molecular Formula | C6H7NO3 |
| Molecular Weight | 141.13 g/mol |
| Exact Mass | 141.04 |
| IUPAC Name | 3-prop-2-enoyl-1,3-oxazolidin-2-one |
| SMILES | C=CC(=O)N1CCOC1=O |
| InChI | InChI=1S/C6H7NO3/c1-2-5(8)7-3-4-10-6(7)9/h2H,1,3-4H2 |
| InChIKey | HIBSYUPTCGGRSD-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.13 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 3-prop-2-enoyl-1,3-oxazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-prop-2-enoyl-1,3-oxazolidin-2-one?
The IUPAC name of 3-prop-2-enoyl-1,3-oxazolidin-2-one (CID 10351788) is 3-prop-2-enoyl-1,3-oxazolidin-2-one.
What is the SMILES notation for 3-prop-2-enoyl-1,3-oxazolidin-2-one?
The canonical SMILES for 3-prop-2-enoyl-1,3-oxazolidin-2-one is C=CC(=O)N1CCOC1=O.
What is the InChIKey of 3-prop-2-enoyl-1,3-oxazolidin-2-one?
The InChIKey is HIBSYUPTCGGRSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7NO3/c1-2-5(8)7-3-4-10-6(7)9/h2H,1,3-4H2.
What are the key properties of 3-prop-2-enoyl-1,3-oxazolidin-2-one?
3-prop-2-enoyl-1,3-oxazolidin-2-one has a molecular weight of 141.13 g/mol, XLogP of 0.15, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-prop-2-enoyl-1,3-oxazolidin-2-one is sourced from PubChem (CID 10351788), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).