C17H24BrN3 — CID 103518312
5-bromo-4-N-(3,5-dimethyl-1-adamantyl)pyridine-3,4-diamine (PubChem CID 103518312) has the molecular formula C17H24BrN3 and a molecular weight of 350.30 g/mol. Its IUPAC name is 5-bromo-4-N-(3,5-dimethyl-1-adamantyl)pyridine-3,4-diamine.
| Compound Name | 5-bromo-4-N-(3,5-dimethyl-1-adamantyl)pyridine-3,4-diamine |
|---|---|
| PubChem CID | 103518312 |
| Molecular Formula | C17H24BrN3 |
| Molecular Weight | 350.30 g/mol |
| Exact Mass | 349.12 |
| IUPAC Name | 5-bromo-4-N-(3,5-dimethyl-1-adamantyl)pyridine-3,4-diamine |
| SMILES | CC12CC3CC(C)(C1)CC(Nc1c(N)cncc1Br)(C3)C2 |
| InChI | InChI=1S/C17H24BrN3/c1-15-3-11-4-16(2,8-15)10-17(5-11,9-15)21-14-12(18)6-20-7-13(14)19/h6-7,11H,3-5,8-10,19H2,1-2H3,(H,20,21) |
| InChIKey | DEZSXKDGCFRWOF-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.30 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |