About 5-bromo-4-N-[[1-(2-methylpropyl)cyclopentyl]methyl]pyridine-3,4-diamine
5-bromo-4-N-[[1-(2-methylpropyl)cyclopentyl]methyl]pyridine-3,4-diamine (PubChem CID 103518322) has the molecular formula C15H24BrN3
and a molecular weight of 326.28 g/mol. Its IUPAC name is 5-bromo-4-N-[[1-(2-methylpropyl)cyclopentyl]methyl]pyridine-3,4-diamine.
Molecular Properties
| Compound Name | 5-bromo-4-N-[[1-(2-methylpropyl)cyclopentyl]methyl]pyridine-3,4-diamine |
| PubChem CID | 103518322 |
| Molecular Formula | C15H24BrN3 |
| Molecular Weight | 326.28 g/mol |
| Exact Mass | 325.12 |
| IUPAC Name | 5-bromo-4-N-[[1-(2-methylpropyl)cyclopentyl]methyl]pyridine-3,4-diamine |
| SMILES | CC(C)CC1(CNc2c(N)cncc2Br)CCCC1 |
| InChI | InChI=1S/C15H24BrN3/c1-11(2)7-15(5-3-4-6-15)10-19-14-12(16)8-18-9-13(14)17/h8-9,11H,3-7,10,17H2,1-2H3,(H,18,19) |
| InChIKey | YZOSRYOEVZFCSB-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.28 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-bromo-4-N-[[1-(2-methylpropyl)cyclopentyl]methyl]pyridine-3,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-4-N-[[1-(2-methylpropyl)cyclopentyl]methyl]pyridine-3,4-diamine?
The IUPAC name of 5-bromo-4-N-[[1-(2-methylpropyl)cyclopentyl]methyl]pyridine-3,4-diamine (CID 103518322) is 5-bromo-4-N-[[1-(2-methylpropyl)cyclopentyl]methyl]pyridine-3,4-diamine.
What is the SMILES notation for 5-bromo-4-N-[[1-(2-methylpropyl)cyclopentyl]methyl]pyridine-3,4-diamine?
The canonical SMILES for 5-bromo-4-N-[[1-(2-methylpropyl)cyclopentyl]methyl]pyridine-3,4-diamine is CC(C)CC1(CNc2c(N)cncc2Br)CCCC1.
What is the InChIKey of 5-bromo-4-N-[[1-(2-methylpropyl)cyclopentyl]methyl]pyridine-3,4-diamine?
The InChIKey is YZOSRYOEVZFCSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24BrN3/c1-11(2)7-15(5-3-4-6-15)10-19-14-12(16)8-18-9-13(14)17/h8-9,11H,3-7,10,17H2,1-2H3,(H,18,19).
What are the key properties of 5-bromo-4-N-[[1-(2-methylpropyl)cyclopentyl]methyl]pyridine-3,4-diamine?
5-bromo-4-N-[[1-(2-methylpropyl)cyclopentyl]methyl]pyridine-3,4-diamine has a molecular weight of 326.28 g/mol, XLogP of 4.44, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-4-N-[[1-(2-methylpropyl)cyclopentyl]methyl]pyridine-3,4-diamine is sourced from PubChem (CID 103518322), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).