C9H14BrN3OS — CID 103518506
5-bromo-4-N-(2-ethylsulfinylethyl)pyridine-3,4-diamine (PubChem CID 103518506) has the molecular formula C9H14BrN3OS and a molecular weight of 292.20 g/mol. Its IUPAC name is 5-bromo-4-N-(2-ethylsulfinylethyl)pyridine-3,4-diamine.
| Compound Name | 5-bromo-4-N-(2-ethylsulfinylethyl)pyridine-3,4-diamine |
|---|---|
| PubChem CID | 103518506 |
| Molecular Formula | C9H14BrN3OS |
| Molecular Weight | 292.20 g/mol |
| Exact Mass | 291.00 |
| IUPAC Name | 5-bromo-4-N-(2-ethylsulfinylethyl)pyridine-3,4-diamine |
| SMILES | CCS(=O)CCNc1c(N)cncc1Br |
| InChI | InChI=1S/C9H14BrN3OS/c1-2-15(14)4-3-13-9-7(10)5-12-6-8(9)11/h5-6H,2-4,11H2,1H3,(H,12,13) |
| InChIKey | BANKDYPENGSUJE-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.20 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |