C9H18Si — CID 10351896
trimethyl-[(1S,2S)-2-prop-2-enylcyclopropyl]silane (PubChem CID 10351896) has the molecular formula C9H18Si and a molecular weight of 154.33 g/mol. Its IUPAC name is trimethyl-[(1S,2S)-2-prop-2-enylcyclopropyl]silane.
| Compound Name | trimethyl-[(1S,2S)-2-prop-2-enylcyclopropyl]silane |
|---|---|
| PubChem CID | 10351896 |
| Molecular Formula | C9H18Si |
| Molecular Weight | 154.33 g/mol |
| Exact Mass | 154.12 |
| IUPAC Name | trimethyl-[(1S,2S)-2-prop-2-enylcyclopropyl]silane |
| SMILES | C=CC[C@H]1C[C@@H]1[Si](C)(C)C |
| InChI | InChI=1S/C9H18Si/c1-5-6-8-7-9(8)10(2,3)4/h5,8-9H,1,6-7H2,2-4H3/t8-,9-/m0/s1 |
| InChIKey | SXIWNNFDDNZVPB-IUCAKERBSA-N |
| XLogP | 3.29 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.33 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|