C10H9BrN6O4 — CID 103518971
1-[2-[(3-bromo-5-nitro-4-pyridinyl)amino]ethyl]triazole-4-carboxylic acid (PubChem CID 103518971) has the molecular formula C10H9BrN6O4 and a molecular weight of 357.12 g/mol. Its IUPAC name is 1-[2-[(3-bromo-5-nitro-4-pyridinyl)amino]ethyl]triazole-4-carboxylic acid.
| Compound Name | 1-[2-[(3-bromo-5-nitro-4-pyridinyl)amino]ethyl]triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 103518971 |
| Molecular Formula | C10H9BrN6O4 |
| Molecular Weight | 357.12 g/mol |
| Exact Mass | 355.99 |
| IUPAC Name | 1-[2-[(3-bromo-5-nitro-4-pyridinyl)amino]ethyl]triazole-4-carboxylic acid |
| SMILES | O=C(O)c1cn(CCNc2c(Br)cncc2[N+](=O)[O-])nn1 |
| InChI | InChI=1S/C10H9BrN6O4/c11-6-3-12-4-8(17(20)21)9(6)13-1-2-16-5-7(10(18)19)14-15-16/h3-5H,1-2H2,(H,12,13)(H,18,19) |
| InChIKey | RFUHDTBKHMCPQI-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 136.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.12 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|