2-(6-oxooxan-2-yl)acetic acid

C7H10O4 — CID 10351944

IUPAC2-(6-oxooxan-2-yl)acetic acid
SMILESO=C(O)CC1CCCC(=O)O1
InChIInChI=1S/C7H10O4/c8-6(9)4-5-2-1-3-7(10)11-5/h5H,1-4H2,(H,8,9)
InChIKeyBNIGQMJUDQGVBJ-UHFFFAOYSA-N
MW158.15 g/mol
LogP0.56
Rot. Bonds2

About 2-(6-oxooxan-2-yl)acetic acid

2-(6-oxooxan-2-yl)acetic acid (PubChem CID 10351944) has the molecular formula C7H10O4 and a molecular weight of 158.15 g/mol. Its IUPAC name is 2-(6-oxooxan-2-yl)acetic acid.

Molecular Properties

Compound Name2-(6-oxooxan-2-yl)acetic acid
PubChem CID10351944
Molecular FormulaC7H10O4
Molecular Weight158.15 g/mol
Exact Mass158.06
IUPAC Name2-(6-oxooxan-2-yl)acetic acid
SMILESO=C(O)CC1CCCC(=O)O1
InChIInChI=1S/C7H10O4/c8-6(9)4-5-2-1-3-7(10)11-5/h5H,1-4H2,(H,8,9)
InChIKeyBNIGQMJUDQGVBJ-UHFFFAOYSA-N
XLogP0.56
TPSA63.60 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500158.15
LogP ≤ 50.56
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-(6-oxooxan-2-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(6-oxooxan-2-yl)acetic acid?
The IUPAC name of 2-(6-oxooxan-2-yl)acetic acid (CID 10351944) is 2-(6-oxooxan-2-yl)acetic acid.
What is the SMILES notation for 2-(6-oxooxan-2-yl)acetic acid?
The canonical SMILES for 2-(6-oxooxan-2-yl)acetic acid is O=C(O)CC1CCCC(=O)O1.
What is the InChIKey of 2-(6-oxooxan-2-yl)acetic acid?
The InChIKey is BNIGQMJUDQGVBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10O4/c8-6(9)4-5-2-1-3-7(10)11-5/h5H,1-4H2,(H,8,9).
What are the key properties of 2-(6-oxooxan-2-yl)acetic acid?
2-(6-oxooxan-2-yl)acetic acid has a molecular weight of 158.15 g/mol, XLogP of 0.56, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6-oxooxan-2-yl)acetic acid is sourced from PubChem (CID 10351944), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).