About 3-(aminomethyl)-2,6-difluorophenol
3-(aminomethyl)-2,6-difluorophenol (PubChem CID 10351955) has the molecular formula C7H7F2NO
and a molecular weight of 159.13 g/mol. Its IUPAC name is 3-(aminomethyl)-2,6-difluorophenol.
Molecular Properties
| Compound Name | 3-(aminomethyl)-2,6-difluorophenol |
| PubChem CID | 10351955 |
| Molecular Formula | C7H7F2NO |
| Molecular Weight | 159.13 g/mol |
| Exact Mass | 159.05 |
| IUPAC Name | 3-(aminomethyl)-2,6-difluorophenol |
| SMILES | NCc1ccc(F)c(O)c1F |
| InChI | InChI=1S/C7H7F2NO/c8-5-2-1-4(3-10)6(9)7(5)11/h1-2,11H,3,10H2 |
| InChIKey | ARLSXSJLCYMMDM-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.13 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(aminomethyl)-2,6-difluorophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(aminomethyl)-2,6-difluorophenol?
The IUPAC name of 3-(aminomethyl)-2,6-difluorophenol (CID 10351955) is 3-(aminomethyl)-2,6-difluorophenol.
What is the SMILES notation for 3-(aminomethyl)-2,6-difluorophenol?
The canonical SMILES for 3-(aminomethyl)-2,6-difluorophenol is NCc1ccc(F)c(O)c1F.
What is the InChIKey of 3-(aminomethyl)-2,6-difluorophenol?
The InChIKey is ARLSXSJLCYMMDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7F2NO/c8-5-2-1-4(3-10)6(9)7(5)11/h1-2,11H,3,10H2.
What are the key properties of 3-(aminomethyl)-2,6-difluorophenol?
3-(aminomethyl)-2,6-difluorophenol has a molecular weight of 159.13 g/mol, XLogP of 1.13, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(aminomethyl)-2,6-difluorophenol is sourced from PubChem (CID 10351955), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).