About bicyclo[2.2.1]hept-2-ene
bicyclo[2.2.1]hept-2-ene (PubChem CID 10352) has the molecular formula C7H10
and a molecular weight of 94.16 g/mol. Its IUPAC name is bicyclo[2.2.1]hept-2-ene.
Molecular Properties
| Compound Name | bicyclo[2.2.1]hept-2-ene |
| PubChem CID | 10352 |
| Molecular Formula | C7H10 |
| Molecular Weight | 94.16 g/mol |
| Exact Mass | 94.08 |
| IUPAC Name | bicyclo[2.2.1]hept-2-ene |
| SMILES | C1=CC2CCC1C2 |
| InChI | InChI=1S/C7H10/c1-2-7-4-3-6(1)5-7/h1-2,6-7H,3-5H2 |
| InChIKey | JFNLZVQOOSMTJK-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 94.16 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze bicyclo[2.2.1]hept-2-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bicyclo[2.2.1]hept-2-ene?
The IUPAC name of bicyclo[2.2.1]hept-2-ene (CID 10352) is bicyclo[2.2.1]hept-2-ene.
What is the SMILES notation for bicyclo[2.2.1]hept-2-ene?
The canonical SMILES for bicyclo[2.2.1]hept-2-ene is C1=CC2CCC1C2.
What is the InChIKey of bicyclo[2.2.1]hept-2-ene?
The InChIKey is JFNLZVQOOSMTJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10/c1-2-7-4-3-6(1)5-7/h1-2,6-7H,3-5H2.
What are the key properties of bicyclo[2.2.1]hept-2-ene?
bicyclo[2.2.1]hept-2-ene has a molecular weight of 94.16 g/mol, XLogP of 1.97, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for bicyclo[2.2.1]hept-2-ene is sourced from PubChem (CID 10352), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).