C5H8O4S — CID 10352025
(3R,4S,5S)-3,4-dihydroxy-5-(hydroxymethyl)thiolan-2-one (PubChem CID 10352025) has the molecular formula C5H8O4S and a molecular weight of 164.18 g/mol. Its IUPAC name is (3R,4S,5S)-3,4-dihydroxy-5-(hydroxymethyl)thiolan-2-one.
| Compound Name | (3R,4S,5S)-3,4-dihydroxy-5-(hydroxymethyl)thiolan-2-one |
|---|---|
| PubChem CID | 10352025 |
| Molecular Formula | C5H8O4S |
| Molecular Weight | 164.18 g/mol |
| Exact Mass | 164.01 |
| IUPAC Name | (3R,4S,5S)-3,4-dihydroxy-5-(hydroxymethyl)thiolan-2-one |
| SMILES | O=C1S[C@@H](CO)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C5H8O4S/c6-1-2-3(7)4(8)5(9)10-2/h2-4,6-8H,1H2/t2-,3+,4+/m0/s1 |
| InChIKey | LBYZYDJBSMPDCJ-PZGQECOJSA-N |
| XLogP | -1.66 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.18 |
| LogP ≤ 5 | -1.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|