About [(2S,3R)-2-methyl-4-oxo-2,3-dihydropyran-3-yl] acetate
[(2S,3R)-2-methyl-4-oxo-2,3-dihydropyran-3-yl] acetate (PubChem CID 10352110) has the molecular formula C8H10O4
and a molecular weight of 170.16 g/mol. Its IUPAC name is [(2S,3R)-2-methyl-4-oxo-2,3-dihydropyran-3-yl] acetate.
Molecular Properties
| Compound Name | [(2S,3R)-2-methyl-4-oxo-2,3-dihydropyran-3-yl] acetate |
| PubChem CID | 10352110 |
| Molecular Formula | C8H10O4 |
| Molecular Weight | 170.16 g/mol |
| Exact Mass | 170.06 |
| IUPAC Name | [(2S,3R)-2-methyl-4-oxo-2,3-dihydropyran-3-yl] acetate |
| SMILES | CC(=O)O[C@H]1C(=O)C=CO[C@H]1C |
| InChI | InChI=1S/C8H10O4/c1-5-8(12-6(2)9)7(10)3-4-11-5/h3-5,8H,1-2H3/t5-,8+/m0/s1 |
| InChIKey | RKADDPYLNFMNRF-YLWLKBPMSA-N |
| XLogP | 0.42 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.16 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [(2S,3R)-2-methyl-4-oxo-2,3-dihydropyran-3-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S,3R)-2-methyl-4-oxo-2,3-dihydropyran-3-yl] acetate?
The IUPAC name of [(2S,3R)-2-methyl-4-oxo-2,3-dihydropyran-3-yl] acetate (CID 10352110) is [(2S,3R)-2-methyl-4-oxo-2,3-dihydropyran-3-yl] acetate.
What is the SMILES notation for [(2S,3R)-2-methyl-4-oxo-2,3-dihydropyran-3-yl] acetate?
The canonical SMILES for [(2S,3R)-2-methyl-4-oxo-2,3-dihydropyran-3-yl] acetate is CC(=O)O[C@H]1C(=O)C=CO[C@H]1C.
What is the InChIKey of [(2S,3R)-2-methyl-4-oxo-2,3-dihydropyran-3-yl] acetate?
The InChIKey is RKADDPYLNFMNRF-YLWLKBPMSA-N. The full InChI is InChI=1S/C8H10O4/c1-5-8(12-6(2)9)7(10)3-4-11-5/h3-5,8H,1-2H3/t5-,8+/m0/s1.
What are the key properties of [(2S,3R)-2-methyl-4-oxo-2,3-dihydropyran-3-yl] acetate?
[(2S,3R)-2-methyl-4-oxo-2,3-dihydropyran-3-yl] acetate has a molecular weight of 170.16 g/mol, XLogP of 0.42, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S,3R)-2-methyl-4-oxo-2,3-dihydropyran-3-yl] acetate is sourced from PubChem (CID 10352110), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).