C12H24N2O2S2 — CID 103521184
3-[cyclopropyl(3,3-dimethylbutylsulfonyl)amino]propanethioamide (PubChem CID 103521184) has the molecular formula C12H24N2O2S2 and a molecular weight of 292.47 g/mol. Its IUPAC name is 3-[cyclopropyl(3,3-dimethylbutylsulfonyl)amino]propanethioamide.
| Compound Name | 3-[cyclopropyl(3,3-dimethylbutylsulfonyl)amino]propanethioamide |
|---|---|
| PubChem CID | 103521184 |
| Molecular Formula | C12H24N2O2S2 |
| Molecular Weight | 292.47 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | 3-[cyclopropyl(3,3-dimethylbutylsulfonyl)amino]propanethioamide |
| SMILES | CC(C)(C)CCS(=O)(=O)N(CCC(N)=S)C1CC1 |
| InChI | InChI=1S/C12H24N2O2S2/c1-12(2,3)7-9-18(15,16)14(10-4-5-10)8-6-11(13)17/h10H,4-9H2,1-3H3,(H2,13,17) |
| InChIKey | WNTYXXWKCDXJCD-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.47 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|