C11H20N2O3S — CID 103521281
1-(3,3-dimethylbutylsulfonyl)-2-isocyanatopyrrolidine (PubChem CID 103521281) has the molecular formula C11H20N2O3S and a molecular weight of 260.36 g/mol. Its IUPAC name is 1-(3,3-dimethylbutylsulfonyl)-2-isocyanatopyrrolidine.
| Compound Name | 1-(3,3-dimethylbutylsulfonyl)-2-isocyanatopyrrolidine |
|---|---|
| PubChem CID | 103521281 |
| Molecular Formula | C11H20N2O3S |
| Molecular Weight | 260.36 g/mol |
| Exact Mass | 260.12 |
| IUPAC Name | 1-(3,3-dimethylbutylsulfonyl)-2-isocyanatopyrrolidine |
| SMILES | CC(C)(C)CCS(=O)(=O)N1CCCC1N=C=O |
| InChI | InChI=1S/C11H20N2O3S/c1-11(2,3)6-8-17(15,16)13-7-4-5-10(13)12-9-14/h10H,4-8H2,1-3H3 |
| InChIKey | PWHSOSKEUFZDFP-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 66.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.36 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|