C9H16OS — CID 10352157
(2S,3S)-2-cyclopentylthiolan-3-ol (PubChem CID 10352157) has the molecular formula C9H16OS and a molecular weight of 172.29 g/mol. Its IUPAC name is (2S,3S)-2-cyclopentylthiolan-3-ol.
| Compound Name | (2S,3S)-2-cyclopentylthiolan-3-ol |
|---|---|
| PubChem CID | 10352157 |
| Molecular Formula | C9H16OS |
| Molecular Weight | 172.29 g/mol |
| Exact Mass | 172.09 |
| IUPAC Name | (2S,3S)-2-cyclopentylthiolan-3-ol |
| SMILES | O[C@H]1CCS[C@H]1C1CCCC1 |
| InChI | InChI=1S/C9H16OS/c10-8-5-6-11-9(8)7-3-1-2-4-7/h7-10H,1-6H2/t8-,9-/m0/s1 |
| InChIKey | VUVHIARICGCKGC-IUCAKERBSA-N |
| XLogP | 2.04 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.29 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |