C11H25N3O3S — CID 103521667
3-(3,3-dimethylbutylsulfonylamino)-N'-hydroxy-2,2-dimethylpropanimidamide (PubChem CID 103521667) has the molecular formula C11H25N3O3S and a molecular weight of 279.41 g/mol. Its IUPAC name is 3-(3,3-dimethylbutylsulfonylamino)-N'-hydroxy-2,2-dimethylpropanimidamide.
| Compound Name | 3-(3,3-dimethylbutylsulfonylamino)-N'-hydroxy-2,2-dimethylpropanimidamide |
|---|---|
| PubChem CID | 103521667 |
| Molecular Formula | C11H25N3O3S |
| Molecular Weight | 279.41 g/mol |
| Exact Mass | 279.16 |
| IUPAC Name | 3-(3,3-dimethylbutylsulfonylamino)-N'-hydroxy-2,2-dimethylpropanimidamide |
| SMILES | CC(C)(C)CCS(=O)(=O)NCC(C)(C)C(N)=NO |
| InChI | InChI=1S/C11H25N3O3S/c1-10(2,3)6-7-18(16,17)13-8-11(4,5)9(12)14-15/h13,15H,6-8H2,1-5H3,(H2,12,14) |
| InChIKey | WZOYJBSKFPECRX-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 104.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.41 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|