About 5-ethenyl-3-phenyl-4,5-dihydro-1,2-oxazole
5-ethenyl-3-phenyl-4,5-dihydro-1,2-oxazole (PubChem CID 10352169) has the molecular formula C11H11NO
and a molecular weight of 173.21 g/mol. Its IUPAC name is 5-ethenyl-3-phenyl-4,5-dihydro-1,2-oxazole.
Molecular Properties
| Compound Name | 5-ethenyl-3-phenyl-4,5-dihydro-1,2-oxazole |
| PubChem CID | 10352169 |
| Molecular Formula | C11H11NO |
| Molecular Weight | 173.21 g/mol |
| Exact Mass | 173.08 |
| IUPAC Name | 5-ethenyl-3-phenyl-4,5-dihydro-1,2-oxazole |
| SMILES | C=CC1CC(c2ccccc2)=NO1 |
| InChI | InChI=1S/C11H11NO/c1-2-10-8-11(12-13-10)9-6-4-3-5-7-9/h2-7,10H,1,8H2 |
| InChIKey | RGJZSIUAKGEEFG-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.21 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-ethenyl-3-phenyl-4,5-dihydro-1,2-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethenyl-3-phenyl-4,5-dihydro-1,2-oxazole?
The IUPAC name of 5-ethenyl-3-phenyl-4,5-dihydro-1,2-oxazole (CID 10352169) is 5-ethenyl-3-phenyl-4,5-dihydro-1,2-oxazole.
What is the SMILES notation for 5-ethenyl-3-phenyl-4,5-dihydro-1,2-oxazole?
The canonical SMILES for 5-ethenyl-3-phenyl-4,5-dihydro-1,2-oxazole is C=CC1CC(c2ccccc2)=NO1.
What is the InChIKey of 5-ethenyl-3-phenyl-4,5-dihydro-1,2-oxazole?
The InChIKey is RGJZSIUAKGEEFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11NO/c1-2-10-8-11(12-13-10)9-6-4-3-5-7-9/h2-7,10H,1,8H2.
What are the key properties of 5-ethenyl-3-phenyl-4,5-dihydro-1,2-oxazole?
5-ethenyl-3-phenyl-4,5-dihydro-1,2-oxazole has a molecular weight of 173.21 g/mol, XLogP of 2.37, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethenyl-3-phenyl-4,5-dihydro-1,2-oxazole is sourced from PubChem (CID 10352169), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).