C11H24ClNO2S — CID 103521702
N-(2-chloroethyl)-3,3-dimethyl-N-propan-2-ylbutane-1-sulfonamide (PubChem CID 103521702) has the molecular formula C11H24ClNO2S and a molecular weight of 269.84 g/mol. Its IUPAC name is N-(2-chloroethyl)-3,3-dimethyl-N-propan-2-ylbutane-1-sulfonamide.
| Compound Name | N-(2-chloroethyl)-3,3-dimethyl-N-propan-2-ylbutane-1-sulfonamide |
|---|---|
| PubChem CID | 103521702 |
| Molecular Formula | C11H24ClNO2S |
| Molecular Weight | 269.84 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | N-(2-chloroethyl)-3,3-dimethyl-N-propan-2-ylbutane-1-sulfonamide |
| SMILES | CC(C)N(CCCl)S(=O)(=O)CCC(C)(C)C |
| InChI | InChI=1S/C11H24ClNO2S/c1-10(2)13(8-7-12)16(14,15)9-6-11(3,4)5/h10H,6-9H2,1-5H3 |
| InChIKey | QKSPCUCSVQOIPN-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.84 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|