About N-(2-bromopropyl)-3,3-dimethylbutane-1-sulfonamide
N-(2-bromopropyl)-3,3-dimethylbutane-1-sulfonamide (PubChem CID 103521789) has the molecular formula C9H20BrNO2S
and a molecular weight of 286.24 g/mol. Its IUPAC name is N-(2-bromopropyl)-3,3-dimethylbutane-1-sulfonamide.
Molecular Properties
| Compound Name | N-(2-bromopropyl)-3,3-dimethylbutane-1-sulfonamide |
| PubChem CID | 103521789 |
| Molecular Formula | C9H20BrNO2S |
| Molecular Weight | 286.24 g/mol |
| Exact Mass | 285.04 |
| IUPAC Name | N-(2-bromopropyl)-3,3-dimethylbutane-1-sulfonamide |
| SMILES | CC(Br)CNS(=O)(=O)CCC(C)(C)C |
| InChI | InChI=1S/C9H20BrNO2S/c1-8(10)7-11-14(12,13)6-5-9(2,3)4/h8,11H,5-7H2,1-4H3 |
| InChIKey | KGLADVJKRSPLBT-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.24 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze N-(2-bromopropyl)-3,3-dimethylbutane-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-bromopropyl)-3,3-dimethylbutane-1-sulfonamide?
The IUPAC name of N-(2-bromopropyl)-3,3-dimethylbutane-1-sulfonamide (CID 103521789) is N-(2-bromopropyl)-3,3-dimethylbutane-1-sulfonamide.
What is the SMILES notation for N-(2-bromopropyl)-3,3-dimethylbutane-1-sulfonamide?
The canonical SMILES for N-(2-bromopropyl)-3,3-dimethylbutane-1-sulfonamide is CC(Br)CNS(=O)(=O)CCC(C)(C)C.
What is the InChIKey of N-(2-bromopropyl)-3,3-dimethylbutane-1-sulfonamide?
The InChIKey is KGLADVJKRSPLBT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H20BrNO2S/c1-8(10)7-11-14(12,13)6-5-9(2,3)4/h8,11H,5-7H2,1-4H3.
What are the key properties of N-(2-bromopropyl)-3,3-dimethylbutane-1-sulfonamide?
N-(2-bromopropyl)-3,3-dimethylbutane-1-sulfonamide has a molecular weight of 286.24 g/mol, XLogP of 2.13, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-bromopropyl)-3,3-dimethylbutane-1-sulfonamide is sourced from PubChem (CID 103521789), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).