C15H19BrO4 — CID 103523120
1-(3-bromo-2,4-dimethoxyphenyl)-2-(oxan-2-yl)ethanone (PubChem CID 103523120) has the molecular formula C15H19BrO4 and a molecular weight of 343.22 g/mol. Its IUPAC name is 1-(3-bromo-2,4-dimethoxyphenyl)-2-(oxan-2-yl)ethanone.
| Compound Name | 1-(3-bromo-2,4-dimethoxyphenyl)-2-(oxan-2-yl)ethanone |
|---|---|
| PubChem CID | 103523120 |
| Molecular Formula | C15H19BrO4 |
| Molecular Weight | 343.22 g/mol |
| Exact Mass | 342.05 |
| IUPAC Name | 1-(3-bromo-2,4-dimethoxyphenyl)-2-(oxan-2-yl)ethanone |
| SMILES | COc1ccc(C(=O)CC2CCCCO2)c(OC)c1Br |
| InChI | InChI=1S/C15H19BrO4/c1-18-13-7-6-11(15(19-2)14(13)16)12(17)9-10-5-3-4-8-20-10/h6-7,10H,3-5,8-9H2,1-2H3 |
| InChIKey | AOGPIAAHEKBNNO-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.22 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |