About 4-(4-methoxycyclohexa-1,4-dien-1-yl)butan-1-ol
4-(4-methoxycyclohexa-1,4-dien-1-yl)butan-1-ol (PubChem CID 10352327) has the molecular formula C11H18O2
and a molecular weight of 182.26 g/mol. Its IUPAC name is 4-(4-methoxycyclohexa-1,4-dien-1-yl)butan-1-ol.
Molecular Properties
| Compound Name | 4-(4-methoxycyclohexa-1,4-dien-1-yl)butan-1-ol |
| PubChem CID | 10352327 |
| Molecular Formula | C11H18O2 |
| Molecular Weight | 182.26 g/mol |
| Exact Mass | 182.13 |
| IUPAC Name | 4-(4-methoxycyclohexa-1,4-dien-1-yl)butan-1-ol |
| SMILES | COC1=CCC(CCCCO)=CC1 |
| InChI | InChI=1S/C11H18O2/c1-13-11-7-5-10(6-8-11)4-2-3-9-12/h5,8,12H,2-4,6-7,9H2,1H3 |
| InChIKey | ABTCFGSVOPYVDZ-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.26 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-(4-methoxycyclohexa-1,4-dien-1-yl)butan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-methoxycyclohexa-1,4-dien-1-yl)butan-1-ol?
The IUPAC name of 4-(4-methoxycyclohexa-1,4-dien-1-yl)butan-1-ol (CID 10352327) is 4-(4-methoxycyclohexa-1,4-dien-1-yl)butan-1-ol.
What is the SMILES notation for 4-(4-methoxycyclohexa-1,4-dien-1-yl)butan-1-ol?
The canonical SMILES for 4-(4-methoxycyclohexa-1,4-dien-1-yl)butan-1-ol is COC1=CCC(CCCCO)=CC1.
What is the InChIKey of 4-(4-methoxycyclohexa-1,4-dien-1-yl)butan-1-ol?
The InChIKey is ABTCFGSVOPYVDZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18O2/c1-13-11-7-5-10(6-8-11)4-2-3-9-12/h5,8,12H,2-4,6-7,9H2,1H3.
What are the key properties of 4-(4-methoxycyclohexa-1,4-dien-1-yl)butan-1-ol?
4-(4-methoxycyclohexa-1,4-dien-1-yl)butan-1-ol has a molecular weight of 182.26 g/mol, XLogP of 2.40, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-methoxycyclohexa-1,4-dien-1-yl)butan-1-ol is sourced from PubChem (CID 10352327), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).