C12H14BrNO2 — CID 103523620
4-(3-bromo-2,4-dimethoxyphenyl)but-3-yn-2-amine (PubChem CID 103523620) has the molecular formula C12H14BrNO2 and a molecular weight of 284.15 g/mol. Its IUPAC name is 4-(3-bromo-2,4-dimethoxyphenyl)but-3-yn-2-amine.
| Compound Name | 4-(3-bromo-2,4-dimethoxyphenyl)but-3-yn-2-amine |
|---|---|
| PubChem CID | 103523620 |
| Molecular Formula | C12H14BrNO2 |
| Molecular Weight | 284.15 g/mol |
| Exact Mass | 283.02 |
| IUPAC Name | 4-(3-bromo-2,4-dimethoxyphenyl)but-3-yn-2-amine |
| SMILES | COc1ccc(C#CC(C)N)c(OC)c1Br |
| InChI | InChI=1S/C12H14BrNO2/c1-8(14)4-5-9-6-7-10(15-2)11(13)12(9)16-3/h6-8H,14H2,1-3H3 |
| InChIKey | NGFQWFSTJCMIDK-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.15 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|