C13H19BrFNO2 — CID 103524213
2-(3-bromo-2,4-dimethoxyphenyl)-2-fluoropentan-1-amine (PubChem CID 103524213) has the molecular formula C13H19BrFNO2 and a molecular weight of 320.20 g/mol. Its IUPAC name is 2-(3-bromo-2,4-dimethoxyphenyl)-2-fluoropentan-1-amine.
| Compound Name | 2-(3-bromo-2,4-dimethoxyphenyl)-2-fluoropentan-1-amine |
|---|---|
| PubChem CID | 103524213 |
| Molecular Formula | C13H19BrFNO2 |
| Molecular Weight | 320.20 g/mol |
| Exact Mass | 319.06 |
| IUPAC Name | 2-(3-bromo-2,4-dimethoxyphenyl)-2-fluoropentan-1-amine |
| SMILES | CCCC(F)(CN)c1ccc(OC)c(Br)c1OC |
| InChI | InChI=1S/C13H19BrFNO2/c1-4-7-13(15,8-16)9-5-6-10(17-2)11(14)12(9)18-3/h5-6H,4,7-8,16H2,1-3H3 |
| InChIKey | SRHTUSRJLGSTFU-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.20 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |