C14H16BrClN2O2S — CID 103524729
[(3-bromo-2,4-dimethoxyphenyl)-(3-chloro-4-methylthiophen-2-yl)methyl]hydrazine (PubChem CID 103524729) has the molecular formula C14H16BrClN2O2S and a molecular weight of 391.72 g/mol. Its IUPAC name is [(3-bromo-2,4-dimethoxyphenyl)-(3-chloro-4-methylthiophen-2-yl)methyl]hydrazine.
| Compound Name | [(3-bromo-2,4-dimethoxyphenyl)-(3-chloro-4-methylthiophen-2-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 103524729 |
| Molecular Formula | C14H16BrClN2O2S |
| Molecular Weight | 391.72 g/mol |
| Exact Mass | 389.98 |
| IUPAC Name | [(3-bromo-2,4-dimethoxyphenyl)-(3-chloro-4-methylthiophen-2-yl)methyl]hydrazine |
| SMILES | COc1ccc(C(NN)c2scc(C)c2Cl)c(OC)c1Br |
| InChI | InChI=1S/C14H16BrClN2O2S/c1-7-6-21-14(11(7)16)12(18-17)8-4-5-9(19-2)10(15)13(8)20-3/h4-6,12,18H,17H2,1-3H3 |
| InChIKey | YKRGSYFVGKDQAC-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.72 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|