About (2R)-2-(3,4-dichlorophenyl)oxirane
(2R)-2-(3,4-dichlorophenyl)oxirane (PubChem CID 10352473) has the molecular formula C8H6Cl2O
and a molecular weight of 189.04 g/mol. Its IUPAC name is (2R)-2-(3,4-dichlorophenyl)oxirane.
Molecular Properties
| Compound Name | (2R)-2-(3,4-dichlorophenyl)oxirane |
| PubChem CID | 10352473 |
| Molecular Formula | C8H6Cl2O |
| Molecular Weight | 189.04 g/mol |
| Exact Mass | 187.98 |
| IUPAC Name | (2R)-2-(3,4-dichlorophenyl)oxirane |
| SMILES | Clc1ccc([C@@H]2CO2)cc1Cl |
| InChI | InChI=1S/C8H6Cl2O/c9-6-2-1-5(3-7(6)10)8-4-11-8/h1-3,8H,4H2/t8-/m0/s1 |
| InChIKey | HIOFHWTUAOODBJ-QMMMGPOBSA-N |
| XLogP | 3.06 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.04 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze (2R)-2-(3,4-dichlorophenyl)oxirane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-(3,4-dichlorophenyl)oxirane?
The IUPAC name of (2R)-2-(3,4-dichlorophenyl)oxirane (CID 10352473) is (2R)-2-(3,4-dichlorophenyl)oxirane.
What is the SMILES notation for (2R)-2-(3,4-dichlorophenyl)oxirane?
The canonical SMILES for (2R)-2-(3,4-dichlorophenyl)oxirane is Clc1ccc([C@@H]2CO2)cc1Cl.
What is the InChIKey of (2R)-2-(3,4-dichlorophenyl)oxirane?
The InChIKey is HIOFHWTUAOODBJ-QMMMGPOBSA-N. The full InChI is InChI=1S/C8H6Cl2O/c9-6-2-1-5(3-7(6)10)8-4-11-8/h1-3,8H,4H2/t8-/m0/s1.
What are the key properties of (2R)-2-(3,4-dichlorophenyl)oxirane?
(2R)-2-(3,4-dichlorophenyl)oxirane has a molecular weight of 189.04 g/mol, XLogP of 3.06, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-(3,4-dichlorophenyl)oxirane is sourced from PubChem (CID 10352473), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).