About 3-amino-2-N,2-N-dimethyl-5-piperazin-1-ylthiophene-2,4-dicarboxamide
3-amino-2-N,2-N-dimethyl-5-piperazin-1-ylthiophene-2,4-dicarboxamide (PubChem CID 103525005) has the molecular formula C12H19N5O2S
and a molecular weight of 297.38 g/mol. Its IUPAC name is 3-amino-2-N,2-N-dimethyl-5-piperazin-1-ylthiophene-2,4-dicarboxamide.
Molecular Properties
| Compound Name | 3-amino-2-N,2-N-dimethyl-5-piperazin-1-ylthiophene-2,4-dicarboxamide |
| PubChem CID | 103525005 |
| Molecular Formula | C12H19N5O2S |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.13 |
| IUPAC Name | 3-amino-2-N,2-N-dimethyl-5-piperazin-1-ylthiophene-2,4-dicarboxamide |
| SMILES | CN(C)C(=O)c1sc(N2CCNCC2)c(C(N)=O)c1N |
| InChI | InChI=1S/C12H19N5O2S/c1-16(2)11(19)9-8(13)7(10(14)18)12(20-9)17-5-3-15-4-6-17/h15H,3-6,13H2,1-2H3,(H2,14,18) |
| InChIKey | XXZBTKNWPTUDNN-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 104.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-amino-2-N,2-N-dimethyl-5-piperazin-1-ylthiophene-2,4-dicarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-2-N,2-N-dimethyl-5-piperazin-1-ylthiophene-2,4-dicarboxamide?
The IUPAC name of 3-amino-2-N,2-N-dimethyl-5-piperazin-1-ylthiophene-2,4-dicarboxamide (CID 103525005) is 3-amino-2-N,2-N-dimethyl-5-piperazin-1-ylthiophene-2,4-dicarboxamide.
What is the SMILES notation for 3-amino-2-N,2-N-dimethyl-5-piperazin-1-ylthiophene-2,4-dicarboxamide?
The canonical SMILES for 3-amino-2-N,2-N-dimethyl-5-piperazin-1-ylthiophene-2,4-dicarboxamide is CN(C)C(=O)c1sc(N2CCNCC2)c(C(N)=O)c1N.
What is the InChIKey of 3-amino-2-N,2-N-dimethyl-5-piperazin-1-ylthiophene-2,4-dicarboxamide?
The InChIKey is XXZBTKNWPTUDNN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19N5O2S/c1-16(2)11(19)9-8(13)7(10(14)18)12(20-9)17-5-3-15-4-6-17/h15H,3-6,13H2,1-2H3,(H2,14,18).
What are the key properties of 3-amino-2-N,2-N-dimethyl-5-piperazin-1-ylthiophene-2,4-dicarboxamide?
3-amino-2-N,2-N-dimethyl-5-piperazin-1-ylthiophene-2,4-dicarboxamide has a molecular weight of 297.38 g/mol, XLogP of -0.46, 3 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-2-N,2-N-dimethyl-5-piperazin-1-ylthiophene-2,4-dicarboxamide is sourced from PubChem (CID 103525005), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).