C10H12F3N3 — CID 103525202
N-(3-methylbut-2-enyl)-6-(trifluoromethyl)pyridazin-3-amine (PubChem CID 103525202) has the molecular formula C10H12F3N3 and a molecular weight of 231.22 g/mol. Its IUPAC name is N-(3-methylbut-2-enyl)-6-(trifluoromethyl)pyridazin-3-amine.
| Compound Name | N-(3-methylbut-2-enyl)-6-(trifluoromethyl)pyridazin-3-amine |
|---|---|
| PubChem CID | 103525202 |
| Molecular Formula | C10H12F3N3 |
| Molecular Weight | 231.22 g/mol |
| Exact Mass | 231.10 |
| IUPAC Name | N-(3-methylbut-2-enyl)-6-(trifluoromethyl)pyridazin-3-amine |
| SMILES | CC(C)=CCNc1ccc(C(F)(F)F)nn1 |
| InChI | InChI=1S/C10H12F3N3/c1-7(2)5-6-14-9-4-3-8(15-16-9)10(11,12)13/h3-5H,6H2,1-2H3,(H,14,16) |
| InChIKey | KSDYYISSNKGASK-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.22 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|