About methyl 2-oxo-1,3-dihydrobenzimidazole-5-carboxylate
methyl 2-oxo-1,3-dihydrobenzimidazole-5-carboxylate (PubChem CID 10352553) has the molecular formula C9H8N2O3
and a molecular weight of 192.17 g/mol. Its IUPAC name is methyl 2-oxo-1,3-dihydrobenzimidazole-5-carboxylate.
Molecular Properties
| Compound Name | methyl 2-oxo-1,3-dihydrobenzimidazole-5-carboxylate |
| PubChem CID | 10352553 |
| Molecular Formula | C9H8N2O3 |
| Molecular Weight | 192.17 g/mol |
| Exact Mass | 192.05 |
| IUPAC Name | methyl 2-oxo-1,3-dihydrobenzimidazole-5-carboxylate |
| SMILES | COC(=O)c1ccc2[nH]c(=O)[nH]c2c1 |
| InChI | InChI=1S/C9H8N2O3/c1-14-8(12)5-2-3-6-7(4-5)11-9(13)10-6/h2-4H,1H3,(H2,10,11,13) |
| InChIKey | KZBROPAHLBJQQC-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 74.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.17 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl 2-oxo-1,3-dihydrobenzimidazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-oxo-1,3-dihydrobenzimidazole-5-carboxylate?
The IUPAC name of methyl 2-oxo-1,3-dihydrobenzimidazole-5-carboxylate (CID 10352553) is methyl 2-oxo-1,3-dihydrobenzimidazole-5-carboxylate.
What is the SMILES notation for methyl 2-oxo-1,3-dihydrobenzimidazole-5-carboxylate?
The canonical SMILES for methyl 2-oxo-1,3-dihydrobenzimidazole-5-carboxylate is COC(=O)c1ccc2[nH]c(=O)[nH]c2c1.
What is the InChIKey of methyl 2-oxo-1,3-dihydrobenzimidazole-5-carboxylate?
The InChIKey is KZBROPAHLBJQQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N2O3/c1-14-8(12)5-2-3-6-7(4-5)11-9(13)10-6/h2-4H,1H3,(H2,10,11,13).
What are the key properties of methyl 2-oxo-1,3-dihydrobenzimidazole-5-carboxylate?
methyl 2-oxo-1,3-dihydrobenzimidazole-5-carboxylate has a molecular weight of 192.17 g/mol, XLogP of 0.64, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-oxo-1,3-dihydrobenzimidazole-5-carboxylate is sourced from PubChem (CID 10352553), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).