C11H21NO3 — CID 103525817
2-(1-methoxycyclobutyl)-N-(2-methylpropoxy)acetamide (PubChem CID 103525817) has the molecular formula C11H21NO3 and a molecular weight of 215.29 g/mol. Its IUPAC name is 2-(1-methoxycyclobutyl)-N-(2-methylpropoxy)acetamide.
| Compound Name | 2-(1-methoxycyclobutyl)-N-(2-methylpropoxy)acetamide |
|---|---|
| PubChem CID | 103525817 |
| Molecular Formula | C11H21NO3 |
| Molecular Weight | 215.29 g/mol |
| Exact Mass | 215.15 |
| IUPAC Name | 2-(1-methoxycyclobutyl)-N-(2-methylpropoxy)acetamide |
| SMILES | COC1(CC(=O)NOCC(C)C)CCC1 |
| InChI | InChI=1S/C11H21NO3/c1-9(2)8-15-12-10(13)7-11(14-3)5-4-6-11/h9H,4-8H2,1-3H3,(H,12,13) |
| InChIKey | BNHRYTRFBDTFEW-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.29 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|